C22H32 — CID 158899228
2,6-ditert-butyl-1,5-dihydro-s-indacene;ethane (PubChem CID 158899228) has the molecular formula C22H32 and a molecular weight of 296.50 g/mol. Its IUPAC name is 2,6-ditert-butyl-1,5-dihydro-s-indacene;ethane.
| Compound Name | 2,6-ditert-butyl-1,5-dihydro-s-indacene;ethane |
|---|---|
| PubChem CID | 158899228 |
| Molecular Formula | C22H32 |
| Molecular Weight | 296.50 g/mol |
| Exact Mass | 296.25 |
| IUPAC Name | 2,6-ditert-butyl-1,5-dihydro-s-indacene;ethane |
| SMILES | CC.CC(C)(C)C1=Cc2cc3c(cc2C1)C=C(C(C)(C)C)C3 |
| InChI | InChI=1S/C20H26.C2H6/c1-19(2,3)17-9-13-7-15-11-18(20(4,5)6)12-16(15)8-14(13)10-17;1-2/h7-9,12H,10-11H2,1-6H3;1-2H3 |
| InChIKey | JFFJOHNRKYGSJN-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.50 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |