C18H26 — CID 160772507
2,6-ditert-butyl-7-methyl-1H-indene (PubChem CID 160772507) has the molecular formula C18H26 and a molecular weight of 242.41 g/mol. Its IUPAC name is 2,6-ditert-butyl-7-methyl-1H-indene.
| Compound Name | 2,6-ditert-butyl-7-methyl-1H-indene |
|---|---|
| PubChem CID | 160772507 |
| Molecular Formula | C18H26 |
| Molecular Weight | 242.41 g/mol |
| Exact Mass | 242.20 |
| IUPAC Name | 2,6-ditert-butyl-7-methyl-1H-indene |
| SMILES | Cc1c(C(C)(C)C)ccc2c1CC(C(C)(C)C)=C2 |
| InChI | InChI=1S/C18H26/c1-12-15-11-14(17(2,3)4)10-13(15)8-9-16(12)18(5,6)7/h8-10H,11H2,1-7H3 |
| InChIKey | PTEYMUXDNYQIGZ-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.41 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |