C17H24Cl2Zr — CID 175509245
2,7-ditert-butyl-1H-indene;dichlorozirconium (PubChem CID 175509245) has the molecular formula C17H24Cl2Zr and a molecular weight of 390.51 g/mol. Its IUPAC name is 2,7-ditert-butyl-1H-indene;dichlorozirconium.
| Compound Name | 2,7-ditert-butyl-1H-indene;dichlorozirconium |
|---|---|
| PubChem CID | 175509245 |
| Molecular Formula | C17H24Cl2Zr |
| Molecular Weight | 390.51 g/mol |
| Exact Mass | 388.03 |
| IUPAC Name | 2,7-ditert-butyl-1H-indene;dichlorozirconium |
| SMILES | CC(C)(C)C1=Cc2cccc(C(C)(C)C)c2C1.Cl[Zr]Cl |
| InChI | InChI=1S/C17H24.2ClH.Zr/c1-16(2,3)13-10-12-8-7-9-15(14(12)11-13)17(4,5)6;;;/h7-10H,11H2,1-6H3;2*1H;/q;;;+2/p-2 |
| InChIKey | WDCAZNFZEJZKBP-UHFFFAOYSA-L |
| XLogP | 6.35 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.51 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |