C43H68 — CID 159432157
1,4-ditert-butylbenzene;1,4-ditert-butylcyclopenta-1,3-diene;2,5-ditert-butyl-1,4-dihydropentalene (PubChem CID 159432157) has the molecular formula C43H68 and a molecular weight of 585.02 g/mol. Its IUPAC name is 1,4-ditert-butylbenzene;1,4-ditert-butylcyclopenta-1,3-diene;2,5-ditert-butyl-1,4-dihydropentalene.
| Compound Name | 1,4-ditert-butylbenzene;1,4-ditert-butylcyclopenta-1,3-diene;2,5-ditert-butyl-1,4-dihydropentalene |
|---|---|
| PubChem CID | 159432157 |
| Molecular Formula | C43H68 |
| Molecular Weight | 585.02 g/mol |
| Exact Mass | 584.53 |
| IUPAC Name | 1,4-ditert-butylbenzene;1,4-ditert-butylcyclopenta-1,3-diene;2,5-ditert-butyl-1,4-dihydropentalene |
| SMILES | CC(C)(C)C1=CC2=C(C=C(C(C)(C)C)C2)C1.CC(C)(C)C1=CC=C(C(C)(C)C)C1.CC(C)(C)c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C16H24.C14H22.C13H22/c1-15(2,3)13-7-11-9-14(16(4,5)6)10-12(11)8-13;1-13(2,3)11-7-9-12(10-8-11)14(4,5)6;1-12(2,3)10-7-8-11(9-10)13(4,5)6/h7,10H,8-9H2,1-6H3;7-10H,1-6H3;7-8H,9H2,1-6H3 |
| InChIKey | LRCQCVJMNNVBLK-UHFFFAOYSA-N |
| XLogP | 13.65 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.02 |
| LogP ≤ 5 | 13.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |