About 2-fluoro-1,4-dimethylcyclopenta-1,3-diene
2-fluoro-1,4-dimethylcyclopenta-1,3-diene (PubChem CID 142132624) has the molecular formula C7H9F
and a molecular weight of 112.15 g/mol. Its IUPAC name is 2-fluoro-1,4-dimethylcyclopenta-1,3-diene.
Analyze 2-fluoro-1,4-dimethylcyclopenta-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoro-1,4-dimethylcyclopenta-1,3-diene?
The IUPAC name of 2-fluoro-1,4-dimethylcyclopenta-1,3-diene (CID 142132624) is 2-fluoro-1,4-dimethylcyclopenta-1,3-diene.
What is the SMILES notation for 2-fluoro-1,4-dimethylcyclopenta-1,3-diene?
The canonical SMILES for 2-fluoro-1,4-dimethylcyclopenta-1,3-diene is CC1=CC(F)=C(C)C1.
What is the InChIKey of 2-fluoro-1,4-dimethylcyclopenta-1,3-diene?
The InChIKey is QJPFHCRACWJSNF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9F/c1-5-3-6(2)7(8)4-5/h4H,3H2,1-2H3.
What are the key properties of 2-fluoro-1,4-dimethylcyclopenta-1,3-diene?
2-fluoro-1,4-dimethylcyclopenta-1,3-diene has a molecular weight of 112.15 g/mol, XLogP of 2.58, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-1,4-dimethylcyclopenta-1,3-diene is sourced from PubChem (CID 142132624), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).