C10H12 — CID 149449471
2,5-dimethyl-1,4-dihydropentalene (PubChem CID 149449471) has the molecular formula C10H12 and a molecular weight of 132.21 g/mol. Its IUPAC name is 2,5-dimethyl-1,4-dihydropentalene.
| Compound Name | 2,5-dimethyl-1,4-dihydropentalene |
|---|---|
| PubChem CID | 149449471 |
| Molecular Formula | C10H12 |
| Molecular Weight | 132.21 g/mol |
| Exact Mass | 132.09 |
| IUPAC Name | 2,5-dimethyl-1,4-dihydropentalene |
| SMILES | CC1=CC2=C(C=C(C)C2)C1 |
| InChI | InChI=1S/C10H12/c1-7-3-9-5-8(2)6-10(9)4-7/h3,6H,4-5H2,1-2H3 |
| InChIKey | YXINUWDKAZQFMJ-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 132.21 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |