C12H16 — CID 142890405
1-methyl-4-[(1Z,3E)-3-methylpenta-1,3-dienyl]cyclopenta-1,3-diene (PubChem CID 142890405) has the molecular formula C12H16 and a molecular weight of 160.26 g/mol. Its IUPAC name is 1-methyl-4-[(1Z,3E)-3-methylpenta-1,3-dienyl]cyclopenta-1,3-diene.
| Compound Name | 1-methyl-4-[(1Z,3E)-3-methylpenta-1,3-dienyl]cyclopenta-1,3-diene |
|---|---|
| PubChem CID | 142890405 |
| Molecular Formula | C12H16 |
| Molecular Weight | 160.26 g/mol |
| Exact Mass | 160.13 |
| IUPAC Name | 1-methyl-4-[(1Z,3E)-3-methylpenta-1,3-dienyl]cyclopenta-1,3-diene |
| SMILES | C/C=C(C)/C=C\C1=CC=C(C)C1 |
| InChI | InChI=1S/C12H16/c1-4-10(2)5-7-12-8-6-11(3)9-12/h4-8H,9H2,1-3H3/b7-5-,10-4+ |
| InChIKey | TWPKKWWECBPRSY-ACUVPTBSSA-N |
| XLogP | 3.79 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.26 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|