C15H16O2 — CID 10105174
(E)-4-[6-[(E)-3-oxobut-1-enyl]cyclohepta-1,3,5-trien-1-yl]but-3-en-2-one (PubChem CID 10105174) has the molecular formula C15H16O2 and a molecular weight of 228.29 g/mol. Its IUPAC name is (E)-4-[6-[(E)-3-oxobut-1-enyl]cyclohepta-1,3,5-trien-1-yl]but-3-en-2-one.
| Compound Name | (E)-4-[6-[(E)-3-oxobut-1-enyl]cyclohepta-1,3,5-trien-1-yl]but-3-en-2-one |
|---|---|
| PubChem CID | 10105174 |
| Molecular Formula | C15H16O2 |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.12 |
| IUPAC Name | (E)-4-[6-[(E)-3-oxobut-1-enyl]cyclohepta-1,3,5-trien-1-yl]but-3-en-2-one |
| SMILES | CC(=O)/C=C/C1=CC=CC=C(/C=C/C(C)=O)C1 |
| InChI | InChI=1S/C15H16O2/c1-12(16)7-9-14-5-3-4-6-15(11-14)10-8-13(2)17/h3-10H,11H2,1-2H3/b9-7+,10-8+ |
| InChIKey | DDDKWOJCSAJPSC-FIFLTTCUSA-N |
| XLogP | 3.09 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|