C17H19BrO4 — CID 11303096
ethyl (E)-2-bromo-3-[6-[(E)-3-ethoxy-3-oxoprop-1-enyl]cyclohepta-1,3,5-trien-1-yl]prop-2-enoate (PubChem CID 11303096) has the molecular formula C17H19BrO4 and a molecular weight of 367.24 g/mol. Its IUPAC name is ethyl (E)-2-bromo-3-[6-[(E)-3-ethoxy-3-oxoprop-1-enyl]cyclohepta-1,3,5-trien-1-yl]prop-2-enoate.
| Compound Name | ethyl (E)-2-bromo-3-[6-[(E)-3-ethoxy-3-oxoprop-1-enyl]cyclohepta-1,3,5-trien-1-yl]prop-2-enoate |
|---|---|
| PubChem CID | 11303096 |
| Molecular Formula | C17H19BrO4 |
| Molecular Weight | 367.24 g/mol |
| Exact Mass | 366.05 |
| IUPAC Name | ethyl (E)-2-bromo-3-[6-[(E)-3-ethoxy-3-oxoprop-1-enyl]cyclohepta-1,3,5-trien-1-yl]prop-2-enoate |
| SMILES | CCOC(=O)/C=C/C1=CC=CC=C(/C=C(/Br)C(=O)OCC)C1 |
| InChI | InChI=1S/C17H19BrO4/c1-3-21-16(19)10-9-13-7-5-6-8-14(11-13)12-15(18)17(20)22-4-2/h5-10,12H,3-4,11H2,1-2H3/b10-9+,15-12+ |
| InChIKey | OLXNIZDYYAYYIX-MKQCFFQWSA-N |
| XLogP | 3.76 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.24 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|