C10H12F2O2 — CID 70806815
ethyl (Z)-3-[(3S,4R)-3,4-difluorocyclopenten-1-yl]prop-2-enoate (PubChem CID 70806815) has the molecular formula C10H12F2O2 and a molecular weight of 202.20 g/mol. Its IUPAC name is ethyl (Z)-3-[(3S,4R)-3,4-difluorocyclopenten-1-yl]prop-2-enoate.
| Compound Name | ethyl (Z)-3-[(3S,4R)-3,4-difluorocyclopenten-1-yl]prop-2-enoate |
|---|---|
| PubChem CID | 70806815 |
| Molecular Formula | C10H12F2O2 |
| Molecular Weight | 202.20 g/mol |
| Exact Mass | 202.08 |
| IUPAC Name | ethyl (Z)-3-[(3S,4R)-3,4-difluorocyclopenten-1-yl]prop-2-enoate |
| SMILES | CCOC(=O)/C=C\C1=C[C@H](F)[C@H](F)C1 |
| InChI | InChI=1S/C10H12F2O2/c1-2-14-10(13)4-3-7-5-8(11)9(12)6-7/h3-5,8-9H,2,6H2,1H3/b4-3-/t8-,9+/m0/s1 |
| InChIKey | UWFORJHWJULQAC-HNRDENNGSA-N |
| XLogP | 2.11 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.20 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|