C9H12O2S — CID 10487745
ethyl (E)-3-(2,3-dihydrothiophen-4-yl)prop-2-enoate (PubChem CID 10487745) has the molecular formula C9H12O2S and a molecular weight of 184.26 g/mol. Its IUPAC name is ethyl (E)-3-(2,3-dihydrothiophen-4-yl)prop-2-enoate.
| Compound Name | ethyl (E)-3-(2,3-dihydrothiophen-4-yl)prop-2-enoate |
|---|---|
| PubChem CID | 10487745 |
| Molecular Formula | C9H12O2S |
| Molecular Weight | 184.26 g/mol |
| Exact Mass | 184.06 |
| IUPAC Name | ethyl (E)-3-(2,3-dihydrothiophen-4-yl)prop-2-enoate |
| SMILES | CCOC(=O)/C=C/C1=CSCC1 |
| InChI | InChI=1S/C9H12O2S/c1-2-11-9(10)4-3-8-5-6-12-7-8/h3-4,7H,2,5-6H2,1H3/b4-3+ |
| InChIKey | TWPAGEGZIWFFKU-ONEGZZNKSA-N |
| XLogP | 2.13 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.26 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|