C10H15NO2 — CID 71376099
ethyl 3-(2,3,4,5-tetrahydropyridin-6-yl)prop-2-enoate (PubChem CID 71376099) has the molecular formula C10H15NO2 and a molecular weight of 181.23 g/mol. Its IUPAC name is ethyl 3-(2,3,4,5-tetrahydropyridin-6-yl)prop-2-enoate.
| Compound Name | ethyl 3-(2,3,4,5-tetrahydropyridin-6-yl)prop-2-enoate |
|---|---|
| PubChem CID | 71376099 |
| Molecular Formula | C10H15NO2 |
| Molecular Weight | 181.23 g/mol |
| Exact Mass | 181.11 |
| IUPAC Name | ethyl 3-(2,3,4,5-tetrahydropyridin-6-yl)prop-2-enoate |
| SMILES | CCOC(=O)C=CC1=NCCCC1 |
| InChI | InChI=1S/C10H15NO2/c1-2-13-10(12)7-6-9-5-3-4-8-11-9/h6-7H,2-5,8H2,1H3 |
| InChIKey | DLIVJOLQBFCEIB-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.23 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|