C28H44O2 — CID 144524510
ethene;4-[4-(4-hydroxycyclohexa-1,3-dien-1-yl)cyclohexa-1,3-dien-1-yl]cyclohexa-1,3-dien-1-ol;propane (PubChem CID 144524510) has the molecular formula C28H44O2 and a molecular weight of 412.66 g/mol. Its IUPAC name is ethene;4-[4-(4-hydroxycyclohexa-1,3-dien-1-yl)cyclohexa-1,3-dien-1-yl]cyclohexa-1,3-dien-1-ol;propane.
| Compound Name | ethene;4-[4-(4-hydroxycyclohexa-1,3-dien-1-yl)cyclohexa-1,3-dien-1-yl]cyclohexa-1,3-dien-1-ol;propane |
|---|---|
| PubChem CID | 144524510 |
| Molecular Formula | C28H44O2 |
| Molecular Weight | 412.66 g/mol |
| Exact Mass | 412.33 |
| IUPAC Name | ethene;4-[4-(4-hydroxycyclohexa-1,3-dien-1-yl)cyclohexa-1,3-dien-1-yl]cyclohexa-1,3-dien-1-ol;propane |
| SMILES | C=C.C=C.CCC.CCC.OC1=CC=C(C2=CC=C(C3=CC=C(O)CC3)CC2)CC1 |
| InChI | InChI=1S/C18H20O2.2C3H8.2C2H4/c19-17-9-5-15(6-10-17)13-1-2-14(4-3-13)16-7-11-18(20)12-8-16;2*1-3-2;2*1-2/h1-2,5,7,9,11,19-20H,3-4,6,8,10,12H2;2*3H2,1-2H3;2*1-2H2 |
| InChIKey | MZTIEFFSHWFAGC-UHFFFAOYSA-N |
| XLogP | 9.39 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.66 |
| LogP ≤ 5 | 9.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|