C7H12N2 — CID 143935131
4-N-methylcyclohexa-1,3-diene-1,4-diamine (PubChem CID 143935131) has the molecular formula C7H12N2 and a molecular weight of 124.19 g/mol. Its IUPAC name is 4-N-methylcyclohexa-1,3-diene-1,4-diamine.
| Compound Name | 4-N-methylcyclohexa-1,3-diene-1,4-diamine |
|---|---|
| PubChem CID | 143935131 |
| Molecular Formula | C7H12N2 |
| Molecular Weight | 124.19 g/mol |
| Exact Mass | 124.10 |
| IUPAC Name | 4-N-methylcyclohexa-1,3-diene-1,4-diamine |
| SMILES | CNC1=CC=C(N)CC1 |
| InChI | InChI=1S/C7H12N2/c1-9-7-4-2-6(8)3-5-7/h2,4,9H,3,5,8H2,1H3 |
| InChIKey | JKEQPZBWEBLGDN-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 124.19 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |