C9H13NO2 — CID 142987823
N-methyl-2,3,7,8-tetrahydro-1,4-benzodioxin-6-amine (PubChem CID 142987823) has the molecular formula C9H13NO2 and a molecular weight of 167.21 g/mol. Its IUPAC name is N-methyl-2,3,7,8-tetrahydro-1,4-benzodioxin-6-amine.
| Compound Name | N-methyl-2,3,7,8-tetrahydro-1,4-benzodioxin-6-amine |
|---|---|
| PubChem CID | 142987823 |
| Molecular Formula | C9H13NO2 |
| Molecular Weight | 167.21 g/mol |
| Exact Mass | 167.09 |
| IUPAC Name | N-methyl-2,3,7,8-tetrahydro-1,4-benzodioxin-6-amine |
| SMILES | CNC1=CC2=C(CC1)OCCO2 |
| InChI | InChI=1S/C9H13NO2/c1-10-7-2-3-8-9(6-7)12-5-4-11-8/h6,10H,2-5H2,1H3 |
| InChIKey | VAAMYNNRHBRGPM-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.21 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |