C9H14O2 — CID 145272383
3,7-dihydro-2H-cyclopenta[b][1,4]dioxine;ethane (PubChem CID 145272383) has the molecular formula C9H14O2 and a molecular weight of 154.21 g/mol. Its IUPAC name is 3,7-dihydro-2H-cyclopenta[b][1,4]dioxine;ethane.
| Compound Name | 3,7-dihydro-2H-cyclopenta[b][1,4]dioxine;ethane |
|---|---|
| PubChem CID | 145272383 |
| Molecular Formula | C9H14O2 |
| Molecular Weight | 154.21 g/mol |
| Exact Mass | 154.10 |
| IUPAC Name | 3,7-dihydro-2H-cyclopenta[b][1,4]dioxine;ethane |
| SMILES | C1=CC2=C(C1)OCCO2.CC |
| InChI | InChI=1S/C7H8O2.C2H6/c1-2-6-7(3-1)9-5-4-8-6;1-2/h1-2H,3-5H2;1-2H3 |
| InChIKey | YJTXVYIDROGXAZ-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.21 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |