C14H22O — CID 143072426
7,7-dimethyl-3,4-dihydro-2H-cyclohepta[b]pyran;ethane (PubChem CID 143072426) has the molecular formula C14H22O and a molecular weight of 206.33 g/mol. Its IUPAC name is 7,7-dimethyl-3,4-dihydro-2H-cyclohepta[b]pyran;ethane.
| Compound Name | 7,7-dimethyl-3,4-dihydro-2H-cyclohepta[b]pyran;ethane |
|---|---|
| PubChem CID | 143072426 |
| Molecular Formula | C14H22O |
| Molecular Weight | 206.33 g/mol |
| Exact Mass | 206.17 |
| IUPAC Name | 7,7-dimethyl-3,4-dihydro-2H-cyclohepta[b]pyran;ethane |
| SMILES | CC.CC1(C)C=CC2=C(C=C1)OCCC2 |
| InChI | InChI=1S/C12H16O.C2H6/c1-12(2)7-5-10-4-3-9-13-11(10)6-8-12;1-2/h5-8H,3-4,9H2,1-2H3;1-2H3 |
| InChIKey | BHNJSVXAIHIOJQ-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.33 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |