C11H10F4O2 — CID 143542265
2,2,3,3-tetrafluoro-7,7-dimethylcyclohepta[b][1,4]dioxine (PubChem CID 143542265) has the molecular formula C11H10F4O2 and a molecular weight of 250.19 g/mol. Its IUPAC name is 2,2,3,3-tetrafluoro-7,7-dimethylcyclohepta[b][1,4]dioxine.
| Compound Name | 2,2,3,3-tetrafluoro-7,7-dimethylcyclohepta[b][1,4]dioxine |
|---|---|
| PubChem CID | 143542265 |
| Molecular Formula | C11H10F4O2 |
| Molecular Weight | 250.19 g/mol |
| Exact Mass | 250.06 |
| IUPAC Name | 2,2,3,3-tetrafluoro-7,7-dimethylcyclohepta[b][1,4]dioxine |
| SMILES | CC1(C)C=CC2=C(C=C1)OC(F)(F)C(F)(F)O2 |
| InChI | InChI=1S/C11H10F4O2/c1-9(2)5-3-7-8(4-6-9)17-11(14,15)10(12,13)16-7/h3-6H,1-2H3 |
| InChIKey | KGYNOOVTVVARHA-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.19 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|