About 7,7-dimethyl-2,3-dihydrocyclohepta[b][1,4]oxathiine
7,7-dimethyl-2,3-dihydrocyclohepta[b][1,4]oxathiine (PubChem CID 143422485) has the molecular formula C11H14OS
and a molecular weight of 194.30 g/mol. Its IUPAC name is 7,7-dimethyl-2,3-dihydrocyclohepta[b][1,4]oxathiine.
Analyze 7,7-dimethyl-2,3-dihydrocyclohepta[b][1,4]oxathiine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7,7-dimethyl-2,3-dihydrocyclohepta[b][1,4]oxathiine?
The IUPAC name of 7,7-dimethyl-2,3-dihydrocyclohepta[b][1,4]oxathiine (CID 143422485) is 7,7-dimethyl-2,3-dihydrocyclohepta[b][1,4]oxathiine.
What is the SMILES notation for 7,7-dimethyl-2,3-dihydrocyclohepta[b][1,4]oxathiine?
The canonical SMILES for 7,7-dimethyl-2,3-dihydrocyclohepta[b][1,4]oxathiine is CC1(C)C=CC2=C(C=C1)SCCO2.
What is the InChIKey of 7,7-dimethyl-2,3-dihydrocyclohepta[b][1,4]oxathiine?
The InChIKey is SPVDDUSZESAQMT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14OS/c1-11(2)5-3-9-10(4-6-11)13-8-7-12-9/h3-6H,7-8H2,1-2H3.
What are the key properties of 7,7-dimethyl-2,3-dihydrocyclohepta[b][1,4]oxathiine?
7,7-dimethyl-2,3-dihydrocyclohepta[b][1,4]oxathiine has a molecular weight of 194.30 g/mol, XLogP of 3.11, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7,7-dimethyl-2,3-dihydrocyclohepta[b][1,4]oxathiine is sourced from PubChem (CID 143422485), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).