C12H14O — CID 163798911
7,7-dimethyl-4H-cyclohepta[b]pyran (PubChem CID 163798911) has the molecular formula C12H14O and a molecular weight of 174.24 g/mol. Its IUPAC name is 7,7-dimethyl-4H-cyclohepta[b]pyran.
| Compound Name | 7,7-dimethyl-4H-cyclohepta[b]pyran |
|---|---|
| PubChem CID | 163798911 |
| Molecular Formula | C12H14O |
| Molecular Weight | 174.24 g/mol |
| Exact Mass | 174.10 |
| IUPAC Name | 7,7-dimethyl-4H-cyclohepta[b]pyran |
| SMILES | CC1(C)C=CC2=C(C=C1)OC=CC2 |
| InChI | InChI=1S/C12H14O/c1-12(2)7-5-10-4-3-9-13-11(10)6-8-12/h3,5-9H,4H2,1-2H3 |
| InChIKey | NDGHQHBGYQTKKC-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.24 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |