C19H23N — CID 145008572
6,6,14,14-tetramethyl-2-azatricyclo[9.5.0.03,9]hexadeca-1(11),3(9),4,7,12,15-hexaene (PubChem CID 145008572) has the molecular formula C19H23N and a molecular weight of 265.40 g/mol. Its IUPAC name is 6,6,14,14-tetramethyl-2-azatricyclo[9.5.0.03,9]hexadeca-1(11),3(9),4,7,12,15-hexaene.
| Compound Name | 6,6,14,14-tetramethyl-2-azatricyclo[9.5.0.03,9]hexadeca-1(11),3(9),4,7,12,15-hexaene |
|---|---|
| PubChem CID | 145008572 |
| Molecular Formula | C19H23N |
| Molecular Weight | 265.40 g/mol |
| Exact Mass | 265.18 |
| IUPAC Name | 6,6,14,14-tetramethyl-2-azatricyclo[9.5.0.03,9]hexadeca-1(11),3(9),4,7,12,15-hexaene |
| SMILES | CC1(C)C=CC2=C(C=C1)NC1=C(C=CC(C)(C)C=C1)C2 |
| InChI | InChI=1S/C19H23N/c1-18(2)9-5-14-13-15-6-10-19(3,4)12-8-17(15)20-16(14)7-11-18/h5-12,20H,13H2,1-4H3 |
| InChIKey | JWGXTRIJDVSFRG-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.40 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |