C13H19NO — CID 155716963
6,6-dimethyl-1,3-dihydrocyclohepta[b]pyrrol-2-one;ethane (PubChem CID 155716963) has the molecular formula C13H19NO and a molecular weight of 205.30 g/mol. Its IUPAC name is 6,6-dimethyl-1,3-dihydrocyclohepta[b]pyrrol-2-one;ethane.
| Compound Name | 6,6-dimethyl-1,3-dihydrocyclohepta[b]pyrrol-2-one;ethane |
|---|---|
| PubChem CID | 155716963 |
| Molecular Formula | C13H19NO |
| Molecular Weight | 205.30 g/mol |
| Exact Mass | 205.15 |
| IUPAC Name | 6,6-dimethyl-1,3-dihydrocyclohepta[b]pyrrol-2-one;ethane |
| SMILES | CC.CC1(C)C=CC2=C(C=C1)NC(=O)C2 |
| InChI | InChI=1S/C11H13NO.C2H6/c1-11(2)5-3-8-7-10(13)12-9(8)4-6-11;1-2/h3-6H,7H2,1-2H3,(H,12,13);1-2H3 |
| InChIKey | NMMZOTBOIAZDOV-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.30 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |