C12H16O — CID 154685717
(2S)-2,6,6-trimethyl-2,3-dihydrocyclohepta[b]furan (PubChem CID 154685717) has the molecular formula C12H16O and a molecular weight of 176.26 g/mol. Its IUPAC name is (2S)-2,6,6-trimethyl-2,3-dihydrocyclohepta[b]furan.
| Compound Name | (2S)-2,6,6-trimethyl-2,3-dihydrocyclohepta[b]furan |
|---|---|
| PubChem CID | 154685717 |
| Molecular Formula | C12H16O |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.12 |
| IUPAC Name | (2S)-2,6,6-trimethyl-2,3-dihydrocyclohepta[b]furan |
| SMILES | C[C@H]1CC2=C(C=CC(C)(C)C=C2)O1 |
| InChI | InChI=1S/C12H16O/c1-9-8-10-4-6-12(2,3)7-5-11(10)13-9/h4-7,9H,8H2,1-3H3/t9-/m0/s1 |
| InChIKey | CCAUNZXCNQYERC-VIFPVBQESA-N |
| XLogP | 3.20 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |