C7H5NO — CID 176542171
1,3-dihydrocyclopenta[b]pyrrol-2-one (PubChem CID 176542171) has the molecular formula C7H5NO and a molecular weight of 119.12 g/mol. Its IUPAC name is 1,3-dihydrocyclopenta[b]pyrrol-2-one.
| Compound Name | 1,3-dihydrocyclopenta[b]pyrrol-2-one |
|---|---|
| PubChem CID | 176542171 |
| Molecular Formula | C7H5NO |
| Molecular Weight | 119.12 g/mol |
| Exact Mass | 119.04 |
| IUPAC Name | 1,3-dihydrocyclopenta[b]pyrrol-2-one |
| SMILES | O=C1CC2=C(C=C=C2)N1 |
| InChI | InChI=1S/C7H5NO/c9-7-4-5-2-1-3-6(5)8-7/h2-3H,4H2,(H,8,9) |
| InChIKey | GAXPVHNTCRPBLG-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 119.12 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |