C4H4N2NaO2S+ — CID 21151290
sodium 2-sulfanylidene-1,3-diazinane-4,6-dione (PubChem CID 21151290) has the molecular formula C4H4N2NaO2S+ and a molecular weight of 167.14 g/mol. Its IUPAC name is sodium 2-sulfanylidene-1,3-diazinane-4,6-dione.
| Compound Name | sodium 2-sulfanylidene-1,3-diazinane-4,6-dione |
|---|---|
| PubChem CID | 21151290 |
| Molecular Formula | C4H4N2NaO2S+ |
| Molecular Weight | 167.14 g/mol |
| Exact Mass | 166.99 |
| IUPAC Name | sodium 2-sulfanylidene-1,3-diazinane-4,6-dione |
| SMILES | O=C1CC(=O)NC(=S)N1.[Na+] |
| InChI | InChI=1S/C4H4N2O2S.Na/c7-2-1-3(8)6-4(9)5-2;/h1H2,(H2,5,6,7,8,9);/q;+1 |
| InChIKey | UZVLHDNOORSKMZ-UHFFFAOYSA-N |
| XLogP | -4.09 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.14 |
| LogP ≤ 5 | -4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|