C4H4N2O2S — CID 15685570
6-sulfanylidene-1,3-diazinane-2,4-dione (PubChem CID 15685570) has the molecular formula C4H4N2O2S and a molecular weight of 144.16 g/mol. Its IUPAC name is 6-sulfanylidene-1,3-diazinane-2,4-dione.
| Compound Name | 6-sulfanylidene-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 15685570 |
| Molecular Formula | C4H4N2O2S |
| Molecular Weight | 144.16 g/mol |
| Exact Mass | 144.00 |
| IUPAC Name | 6-sulfanylidene-1,3-diazinane-2,4-dione |
| SMILES | O=C1CC(=S)NC(=O)N1 |
| InChI | InChI=1S/C4H4N2O2S/c7-2-1-3(9)6-4(8)5-2/h1H2,(H2,5,6,7,8,9) |
| InChIKey | CWQRZHJVEYUBDY-UHFFFAOYSA-N |
| XLogP | -0.46 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.16 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|