C4H7N3OS — CID 71303898
6-amino-2-sulfanylidene-1,3-diazinan-4-one (PubChem CID 71303898) has the molecular formula C4H7N3OS and a molecular weight of 145.19 g/mol. Its IUPAC name is 6-amino-2-sulfanylidene-1,3-diazinan-4-one.
| Compound Name | 6-amino-2-sulfanylidene-1,3-diazinan-4-one |
|---|---|
| PubChem CID | 71303898 |
| Molecular Formula | C4H7N3OS |
| Molecular Weight | 145.19 g/mol |
| Exact Mass | 145.03 |
| IUPAC Name | 6-amino-2-sulfanylidene-1,3-diazinan-4-one |
| SMILES | NC1CC(=O)NC(=S)N1 |
| InChI | InChI=1S/C4H7N3OS/c5-2-1-3(8)7-4(9)6-2/h2H,1,5H2,(H2,6,7,8,9) |
| InChIKey | IWXQGLKXRNXAPY-UHFFFAOYSA-N |
| XLogP | -1.33 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 145.19 |
| LogP ≤ 5 | -1.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|