C20H20O2 — CID 142049970
6,6,14,14-tetramethyltricyclo[9.5.0.03,9]hexadeca-1(11),3(9),4,7,12,15-hexaene-2,10-dione (PubChem CID 142049970) has the molecular formula C20H20O2 and a molecular weight of 292.38 g/mol. Its IUPAC name is 6,6,14,14-tetramethyltricyclo[9.5.0.03,9]hexadeca-1(11),3(9),4,7,12,15-hexaene-2,10-dione.
| Compound Name | 6,6,14,14-tetramethyltricyclo[9.5.0.03,9]hexadeca-1(11),3(9),4,7,12,15-hexaene-2,10-dione |
|---|---|
| PubChem CID | 142049970 |
| Molecular Formula | C20H20O2 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.15 |
| IUPAC Name | 6,6,14,14-tetramethyltricyclo[9.5.0.03,9]hexadeca-1(11),3(9),4,7,12,15-hexaene-2,10-dione |
| SMILES | CC1(C)C=CC2=C(C=C1)C(=O)C1=C(C=CC(C)(C)C=C1)C2=O |
| InChI | InChI=1S/C20H20O2/c1-19(2)9-5-13-14(6-10-19)18(22)16-8-12-20(3,4)11-7-15(16)17(13)21/h5-12H,1-4H3 |
| InChIKey | YGJUPTQEEWOLPI-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|