C15H20N2O — CID 143109453
2,4,6,10,10-pentamethyl-2,5-diazabicyclo[5.5.0]dodeca-1(7),5,8,11-tetraen-3-one (PubChem CID 143109453) has the molecular formula C15H20N2O and a molecular weight of 244.34 g/mol. Its IUPAC name is 2,4,6,10,10-pentamethyl-2,5-diazabicyclo[5.5.0]dodeca-1(7),5,8,11-tetraen-3-one.
| Compound Name | 2,4,6,10,10-pentamethyl-2,5-diazabicyclo[5.5.0]dodeca-1(7),5,8,11-tetraen-3-one |
|---|---|
| PubChem CID | 143109453 |
| Molecular Formula | C15H20N2O |
| Molecular Weight | 244.34 g/mol |
| Exact Mass | 244.16 |
| IUPAC Name | 2,4,6,10,10-pentamethyl-2,5-diazabicyclo[5.5.0]dodeca-1(7),5,8,11-tetraen-3-one |
| SMILES | CC1=NC(C)C(=O)N(C)C2=C1C=CC(C)(C)C=C2 |
| InChI | InChI=1S/C15H20N2O/c1-10-12-6-8-15(3,4)9-7-13(12)17(5)14(18)11(2)16-10/h6-9,11H,1-5H3 |
| InChIKey | VYZJIWYWWJKESH-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.34 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |