C11H12NO2P — CID 143478279
2,6-dimethyl-6-phosphanylcyclohepta[c]pyrrole-1,3-dione (PubChem CID 143478279) has the molecular formula C11H12NO2P and a molecular weight of 221.20 g/mol. Its IUPAC name is 2,6-dimethyl-6-phosphanylcyclohepta[c]pyrrole-1,3-dione.
| Compound Name | 2,6-dimethyl-6-phosphanylcyclohepta[c]pyrrole-1,3-dione |
|---|---|
| PubChem CID | 143478279 |
| Molecular Formula | C11H12NO2P |
| Molecular Weight | 221.20 g/mol |
| Exact Mass | 221.06 |
| IUPAC Name | 2,6-dimethyl-6-phosphanylcyclohepta[c]pyrrole-1,3-dione |
| SMILES | CN1C(=O)C2=C(C=CC(C)(P)C=C2)C1=O |
| InChI | InChI=1S/C11H12NO2P/c1-11(15)5-3-7-8(4-6-11)10(14)12(2)9(7)13/h3-6H,15H2,1-2H3 |
| InChIKey | POHDUCQJMZOZAJ-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.20 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|