C11H13NO2 — CID 146915530
2,6-dimethyl-7,8-dihydro-6H-cyclohepta[c]pyrrole-1,3-dione (PubChem CID 146915530) has the molecular formula C11H13NO2 and a molecular weight of 191.23 g/mol. Its IUPAC name is 2,6-dimethyl-7,8-dihydro-6H-cyclohepta[c]pyrrole-1,3-dione.
| Compound Name | 2,6-dimethyl-7,8-dihydro-6H-cyclohepta[c]pyrrole-1,3-dione |
|---|---|
| PubChem CID | 146915530 |
| Molecular Formula | C11H13NO2 |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.09 |
| IUPAC Name | 2,6-dimethyl-7,8-dihydro-6H-cyclohepta[c]pyrrole-1,3-dione |
| SMILES | CC1C=CC2=C(CC1)C(=O)N(C)C2=O |
| InChI | InChI=1S/C11H13NO2/c1-7-3-5-8-9(6-4-7)11(14)12(2)10(8)13/h3,5,7H,4,6H2,1-2H3 |
| InChIKey | ACDQBGMQBHOGSA-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|