C14H16NO2P — CID 163499108
(5R)-9-methyl-5-oxo-10,11-dihydro-9H-cyclohepta[c][2,1]benzoxaphosphinin-5-amine (PubChem CID 163499108) has the molecular formula C14H16NO2P and a molecular weight of 261.26 g/mol. Its IUPAC name is (5R)-9-methyl-5-oxo-10,11-dihydro-9H-cyclohepta[c][2,1]benzoxaphosphinin-5-amine.
| Compound Name | (5R)-9-methyl-5-oxo-10,11-dihydro-9H-cyclohepta[c][2,1]benzoxaphosphinin-5-amine |
|---|---|
| PubChem CID | 163499108 |
| Molecular Formula | C14H16NO2P |
| Molecular Weight | 261.26 g/mol |
| Exact Mass | 261.09 |
| IUPAC Name | (5R)-9-methyl-5-oxo-10,11-dihydro-9H-cyclohepta[c][2,1]benzoxaphosphinin-5-amine |
| SMILES | CC1C=CC2=C(CC1)c1ccccc1[P@@](N)(=O)O2 |
| InChI | InChI=1S/C14H16NO2P/c1-10-6-8-11-12-4-2-3-5-14(12)18(15,16)17-13(11)9-7-10/h2-5,7,9-10H,6,8H2,1H3,(H2,15,16)/t10?,18-/m1/s1 |
| InChIKey | CTEIXHUQADXQJZ-RXUIWSPKSA-N |
| XLogP | 3.19 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.26 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|