C21H21O2P — CID 158354295
6-methylbenzo[c][2,1]benzoxaphosphinine 6-oxide;1,4-xylene (PubChem CID 158354295) has the molecular formula C21H21O2P and a molecular weight of 336.37 g/mol. Its IUPAC name is 6-methylbenzo[c][2,1]benzoxaphosphinine 6-oxide;1,4-xylene.
| Compound Name | 6-methylbenzo[c][2,1]benzoxaphosphinine 6-oxide;1,4-xylene |
|---|---|
| PubChem CID | 158354295 |
| Molecular Formula | C21H21O2P |
| Molecular Weight | 336.37 g/mol |
| Exact Mass | 336.13 |
| IUPAC Name | 6-methylbenzo[c][2,1]benzoxaphosphinine 6-oxide;1,4-xylene |
| SMILES | CP1(=O)Oc2ccccc2-c2ccccc21.Cc1ccc(C)cc1 |
| InChI | InChI=1S/C13H11O2P.C8H10/c1-16(14)13-9-5-3-7-11(13)10-6-2-4-8-12(10)15-16;1-7-3-5-8(2)6-4-7/h2-9H,1H3;3-6H,1-2H3 |
| InChIKey | GSRNYEMEIMGPMG-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.37 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|