C18H25OP — CID 159397412
ethane;6-methyl-6-methylidenebenzo[c][2,1]benzoxaphosphinine (PubChem CID 159397412) has the molecular formula C18H25OP and a molecular weight of 288.37 g/mol. Its IUPAC name is ethane;6-methyl-6-methylidenebenzo[c][2,1]benzoxaphosphinine.
| Compound Name | ethane;6-methyl-6-methylidenebenzo[c][2,1]benzoxaphosphinine |
|---|---|
| PubChem CID | 159397412 |
| Molecular Formula | C18H25OP |
| Molecular Weight | 288.37 g/mol |
| Exact Mass | 288.16 |
| IUPAC Name | ethane;6-methyl-6-methylidenebenzo[c][2,1]benzoxaphosphinine |
| SMILES | C=P1(C)Oc2ccccc2-c2ccccc21.CC.CC |
| InChI | InChI=1S/C14H13OP.2C2H6/c1-16(2)14-10-6-4-8-12(14)11-7-3-5-9-13(11)15-16;2*1-2/h3-10H,1H2,2H3;2*1-2H3 |
| InChIKey | LMXGCBSXLBQDQT-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.37 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|