C12H9ClOPS+ — CID 163915272
(6-sulfanylidenebenzo[c][2,1]benzoxaphosphinin-6-yl)chloranium (PubChem CID 163915272) has the molecular formula C12H9ClOPS+ and a molecular weight of 267.70 g/mol. Its IUPAC name is (6-sulfanylidenebenzo[c][2,1]benzoxaphosphinin-6-yl)chloranium.
| Compound Name | (6-sulfanylidenebenzo[c][2,1]benzoxaphosphinin-6-yl)chloranium |
|---|---|
| PubChem CID | 163915272 |
| Molecular Formula | C12H9ClOPS+ |
| Molecular Weight | 267.70 g/mol |
| Exact Mass | 266.98 |
| IUPAC Name | (6-sulfanylidenebenzo[c][2,1]benzoxaphosphinin-6-yl)chloranium |
| SMILES | S=P1([ClH+])Oc2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C12H9ClOPS/c13-15(16)12-8-4-2-6-10(12)9-5-1-3-7-11(9)14-15/h1-8,13H/q+1 |
| InChIKey | QVRNZYUILOCMFQ-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.70 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|