C12H9O3PS — CID 6914045
6-hydroxy-6-sulfanylidenebenzo[d][1,3,2]benzodioxaphosphepine (PubChem CID 6914045) has the molecular formula C12H9O3PS and a molecular weight of 264.24 g/mol. Its IUPAC name is 6-hydroxy-6-sulfanylidenebenzo[d][1,3,2]benzodioxaphosphepine.
| Compound Name | 6-hydroxy-6-sulfanylidenebenzo[d][1,3,2]benzodioxaphosphepine |
|---|---|
| PubChem CID | 6914045 |
| Molecular Formula | C12H9O3PS |
| Molecular Weight | 264.24 g/mol |
| Exact Mass | 264.00 |
| IUPAC Name | 6-hydroxy-6-sulfanylidenebenzo[d][1,3,2]benzodioxaphosphepine |
| SMILES | OP1(=S)Oc2ccccc2-c2ccccc2O1 |
| InChI | InChI=1S/C12H9O3PS/c13-16(17)14-11-7-3-1-5-9(11)10-6-2-4-8-12(10)15-16/h1-8H,(H,13,17) |
| InChIKey | GQZWFOQUTCHWHX-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.24 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|