C14H14NOP — CID 170372495
6-methyl-6-methyliminobenzo[c][2,1]benzoxaphosphinine (PubChem CID 170372495) has the molecular formula C14H14NOP and a molecular weight of 243.25 g/mol. Its IUPAC name is 6-methyl-6-methyliminobenzo[c][2,1]benzoxaphosphinine.
| Compound Name | 6-methyl-6-methyliminobenzo[c][2,1]benzoxaphosphinine |
|---|---|
| PubChem CID | 170372495 |
| Molecular Formula | C14H14NOP |
| Molecular Weight | 243.25 g/mol |
| Exact Mass | 243.08 |
| IUPAC Name | 6-methyl-6-methyliminobenzo[c][2,1]benzoxaphosphinine |
| SMILES | CN=P1(C)Oc2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C14H14NOP/c1-15-17(2)14-10-6-4-8-12(14)11-7-3-5-9-13(11)16-17/h3-10H,1-2H3 |
| InChIKey | JTWWKXQRFXBCJH-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.25 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|