C19H15O3P — CID 126692418
4-[(6-oxobenzo[c][2,1]benzoxaphosphinin-6-yl)methyl]phenol (PubChem CID 126692418) has the molecular formula C19H15O3P and a molecular weight of 322.30 g/mol. Its IUPAC name is 4-[(6-oxobenzo[c][2,1]benzoxaphosphinin-6-yl)methyl]phenol.
| Compound Name | 4-[(6-oxobenzo[c][2,1]benzoxaphosphinin-6-yl)methyl]phenol |
|---|---|
| PubChem CID | 126692418 |
| Molecular Formula | C19H15O3P |
| Molecular Weight | 322.30 g/mol |
| Exact Mass | 322.08 |
| IUPAC Name | 4-[(6-oxobenzo[c][2,1]benzoxaphosphinin-6-yl)methyl]phenol |
| SMILES | O=P1(Cc2ccc(O)cc2)Oc2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C19H15O3P/c20-15-11-9-14(10-12-15)13-23(21)19-8-4-2-6-17(19)16-5-1-3-7-18(16)22-23/h1-12,20H,13H2 |
| InChIKey | UNQVHXNJOJYTPT-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.30 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|