C46H38N2O6P2 — CID 102195564
2-[[4-[(2-hydroxyphenyl)methyl-[(6-oxobenzo[c][2,1]benzoxaphosphinin-6-yl)methyl]amino]-N-[(6-oxobenzo[c][2,1]benzoxaphosphinin-6-yl)methyl]anilino]methyl]phenol (PubChem CID 102195564) has the molecular formula C46H38N2O6P2 and a molecular weight of 776.77 g/mol. Its IUPAC name is 2-[[4-[(2-hydroxyphenyl)methyl-[(6-oxobenzo[c][2,1]benzoxaphosphinin-6-yl)methyl]amino]-N-[(6-oxobenzo[c][2,1]benzoxaphosphinin-6-yl)methyl]anilino]methyl]phenol.
| Compound Name | 2-[[4-[(2-hydroxyphenyl)methyl-[(6-oxobenzo[c][2,1]benzoxaphosphinin-6-yl)methyl]amino]-N-[(6-oxobenzo[c][2,1]benzoxaphosphinin-6-yl)methyl]anilino]methyl]phenol |
|---|---|
| PubChem CID | 102195564 |
| Molecular Formula | C46H38N2O6P2 |
| Molecular Weight | 776.77 g/mol |
| Exact Mass | 776.22 |
| IUPAC Name | 2-[[4-[(2-hydroxyphenyl)methyl-[(6-oxobenzo[c][2,1]benzoxaphosphinin-6-yl)methyl]amino]-N-[(6-oxobenzo[c][2,1]benzoxaphosphinin-6-yl)methyl]anilino]methyl]phenol |
| SMILES | O=P1(CN(Cc2ccccc2O)c2ccc(N(Cc3ccccc3O)CP3(=O)Oc4ccccc4-c4ccccc43)cc2)Oc2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C46H38N2O6P2/c49-41-19-7-1-13-33(41)29-47(31-55(51)45-23-11-5-17-39(45)37-15-3-9-21-43(37)53-55)35-25-27-36(28-26-35)48(30-34-14-2-8-20-42(34)50)32-56(52)46-24-12-6-18-40(46)38-16-4-10-22-44(38)54-56/h1-28,49-50H,29-32H2 |
| InChIKey | MVVBVKKBKHXPHJ-UHFFFAOYSA-N |
| XLogP | 10.35 |
| TPSA | 99.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 776.77 |
| LogP ≤ 5 | 10.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|