C17H15O6P — CID 6454648
2-[(6-oxobenzo[c][2,1]benzoxaphosphinin-6-yl)methyl]butanedioic acid (PubChem CID 6454648) has the molecular formula C17H15O6P and a molecular weight of 346.27 g/mol. Its IUPAC name is 2-[(6-oxobenzo[c][2,1]benzoxaphosphinin-6-yl)methyl]butanedioic acid.
| Compound Name | 2-[(6-oxobenzo[c][2,1]benzoxaphosphinin-6-yl)methyl]butanedioic acid |
|---|---|
| PubChem CID | 6454648 |
| Molecular Formula | C17H15O6P |
| Molecular Weight | 346.27 g/mol |
| Exact Mass | 346.06 |
| IUPAC Name | 2-[(6-oxobenzo[c][2,1]benzoxaphosphinin-6-yl)methyl]butanedioic acid |
| SMILES | O=C(O)CC(CP1(=O)Oc2ccccc2-c2ccccc21)C(=O)O |
| InChI | InChI=1S/C17H15O6P/c18-16(19)9-11(17(20)21)10-24(22)15-8-4-2-6-13(15)12-5-1-3-7-14(12)23-24/h1-8,11H,9-10H2,(H,18,19)(H,20,21) |
| InChIKey | XZAXQWXHBDKYJI-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.27 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|