C23H23O3P — CID 23594103
1-[4-[(6-oxobenzo[c][2,1]benzoxaphosphinin-6-yl)methyl]phenyl]butan-2-ol (PubChem CID 23594103) has the molecular formula C23H23O3P and a molecular weight of 378.41 g/mol. Its IUPAC name is 1-[4-[(6-oxobenzo[c][2,1]benzoxaphosphinin-6-yl)methyl]phenyl]butan-2-ol.
| Compound Name | 1-[4-[(6-oxobenzo[c][2,1]benzoxaphosphinin-6-yl)methyl]phenyl]butan-2-ol |
|---|---|
| PubChem CID | 23594103 |
| Molecular Formula | C23H23O3P |
| Molecular Weight | 378.41 g/mol |
| Exact Mass | 378.14 |
| IUPAC Name | 1-[4-[(6-oxobenzo[c][2,1]benzoxaphosphinin-6-yl)methyl]phenyl]butan-2-ol |
| SMILES | CCC(O)Cc1ccc(CP2(=O)Oc3ccccc3-c3ccccc32)cc1 |
| InChI | InChI=1S/C23H23O3P/c1-2-19(24)15-17-11-13-18(14-12-17)16-27(25)23-10-6-4-8-21(23)20-7-3-5-9-22(20)26-27/h3-14,19,24H,2,15-16H2,1H3 |
| InChIKey | YEHRBMZLWREIRC-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.41 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|