C21H23O4P — CID 142563894
6-methyl-3-[(6-oxobenzo[c][2,1]benzoxaphosphinin-6-yl)methyl]heptane-2,5-dione (PubChem CID 142563894) has the molecular formula C21H23O4P and a molecular weight of 370.39 g/mol. Its IUPAC name is 6-methyl-3-[(6-oxobenzo[c][2,1]benzoxaphosphinin-6-yl)methyl]heptane-2,5-dione.
| Compound Name | 6-methyl-3-[(6-oxobenzo[c][2,1]benzoxaphosphinin-6-yl)methyl]heptane-2,5-dione |
|---|---|
| PubChem CID | 142563894 |
| Molecular Formula | C21H23O4P |
| Molecular Weight | 370.39 g/mol |
| Exact Mass | 370.13 |
| IUPAC Name | 6-methyl-3-[(6-oxobenzo[c][2,1]benzoxaphosphinin-6-yl)methyl]heptane-2,5-dione |
| SMILES | CC(=O)C(CC(=O)C(C)C)CP1(=O)Oc2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C21H23O4P/c1-14(2)19(23)12-16(15(3)22)13-26(24)21-11-7-5-9-18(21)17-8-4-6-10-20(17)25-26/h4-11,14,16H,12-13H2,1-3H3 |
| InChIKey | HTFBEKUKGASQLY-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.39 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|