C20H27O5PSi — CID 157290847
triethoxy-[2-[(6R)-6-oxobenzo[c][2,1]benzoxaphosphinin-6-yl]ethyl]silane (PubChem CID 157290847) has the molecular formula C20H27O5PSi and a molecular weight of 406.49 g/mol. Its IUPAC name is triethoxy-[2-[(6R)-6-oxobenzo[c][2,1]benzoxaphosphinin-6-yl]ethyl]silane.
| Compound Name | triethoxy-[2-[(6R)-6-oxobenzo[c][2,1]benzoxaphosphinin-6-yl]ethyl]silane |
|---|---|
| PubChem CID | 157290847 |
| Molecular Formula | C20H27O5PSi |
| Molecular Weight | 406.49 g/mol |
| Exact Mass | 406.14 |
| IUPAC Name | triethoxy-[2-[(6R)-6-oxobenzo[c][2,1]benzoxaphosphinin-6-yl]ethyl]silane |
| SMILES | CCO[Si](CC[P@@]1(=O)Oc2ccccc2-c2ccccc21)(OCC)OCC |
| InChI | InChI=1S/C20H27O5PSi/c1-4-22-27(23-5-2,24-6-3)16-15-26(21)20-14-10-8-12-18(20)17-11-7-9-13-19(17)25-26/h7-14H,4-6,15-16H2,1-3H3/t26-/m1/s1 |
| InChIKey | BAUAOAULDJMZMI-AREMUKBSSA-N |
| XLogP | 4.70 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.49 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|