C16H16NO4P — CID 123501357
methylamino 3-(6-oxobenzo[c][2,1]benzoxaphosphinin-6-yl)propanoate (PubChem CID 123501357) has the molecular formula C16H16NO4P and a molecular weight of 317.28 g/mol. Its IUPAC name is methylamino 3-(6-oxobenzo[c][2,1]benzoxaphosphinin-6-yl)propanoate.
| Compound Name | methylamino 3-(6-oxobenzo[c][2,1]benzoxaphosphinin-6-yl)propanoate |
|---|---|
| PubChem CID | 123501357 |
| Molecular Formula | C16H16NO4P |
| Molecular Weight | 317.28 g/mol |
| Exact Mass | 317.08 |
| IUPAC Name | methylamino 3-(6-oxobenzo[c][2,1]benzoxaphosphinin-6-yl)propanoate |
| SMILES | CNOC(=O)CCP1(=O)Oc2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C16H16NO4P/c1-17-20-16(18)10-11-22(19)15-9-5-3-7-13(15)12-6-2-4-8-14(12)21-22/h2-9,17H,10-11H2,1H3 |
| InChIKey | FCPCCACTJDPFJJ-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.28 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|