About zinc;3-(6-oxobenzo[c][2,1]benzoxaphosphinin-6-yl)propanoate;prop-2-enoic acid
zinc;3-(6-oxobenzo[c][2,1]benzoxaphosphinin-6-yl)propanoate;prop-2-enoic acid (PubChem CID 161370462) has the molecular formula C18H16O6PZn+
and a molecular weight of 424.68 g/mol. Its IUPAC name is zinc;3-(6-oxobenzo[c][2,1]benzoxaphosphinin-6-yl)propanoate;prop-2-enoic acid.
Molecular Properties
| Compound Name | zinc;3-(6-oxobenzo[c][2,1]benzoxaphosphinin-6-yl)propanoate;prop-2-enoic acid |
| PubChem CID | 161370462 |
| Molecular Formula | C18H16O6PZn+ |
| Molecular Weight | 424.68 g/mol |
| Exact Mass | 423.00 |
| IUPAC Name | zinc;3-(6-oxobenzo[c][2,1]benzoxaphosphinin-6-yl)propanoate;prop-2-enoic acid |
| SMILES | C=CC(=O)O.O=C([O-])CCP1(=O)Oc2ccccc2-c2ccccc21.[Zn+2] |
| InChI | InChI=1S/C15H13O4P.C3H4O2.Zn/c16-15(17)9-10-20(18)14-8-4-2-6-12(14)11-5-1-3-7-13(11)19-20;1-2-3(4)5;/h1-8H,9-10H2,(H,16,17);2H,1H2,(H,4,5);/q;;+2/p-1 |
| InChIKey | VQJWVLALLIZPRZ-UHFFFAOYSA-M |
| XLogP | 2.04 |
| TPSA | 103.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 424.68 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze zinc;3-(6-oxobenzo[c][2,1]benzoxaphosphinin-6-yl)propanoate;prop-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of zinc;3-(6-oxobenzo[c][2,1]benzoxaphosphinin-6-yl)propanoate;prop-2-enoic acid?
The IUPAC name of zinc;3-(6-oxobenzo[c][2,1]benzoxaphosphinin-6-yl)propanoate;prop-2-enoic acid (CID 161370462) is zinc;3-(6-oxobenzo[c][2,1]benzoxaphosphinin-6-yl)propanoate;prop-2-enoic acid.
What is the SMILES notation for zinc;3-(6-oxobenzo[c][2,1]benzoxaphosphinin-6-yl)propanoate;prop-2-enoic acid?
The canonical SMILES for zinc;3-(6-oxobenzo[c][2,1]benzoxaphosphinin-6-yl)propanoate;prop-2-enoic acid is C=CC(=O)O.O=C([O-])CCP1(=O)Oc2ccccc2-c2ccccc21.[Zn+2].
What is the InChIKey of zinc;3-(6-oxobenzo[c][2,1]benzoxaphosphinin-6-yl)propanoate;prop-2-enoic acid?
The InChIKey is VQJWVLALLIZPRZ-UHFFFAOYSA-M. The full InChI is InChI=1S/C15H13O4P.C3H4O2.Zn/c16-15(17)9-10-20(18)14-8-4-2-6-12(14)11-5-1-3-7-13(11)19-20;1-2-3(4)5;/h1-8H,9-10H2,(H,16,17);2H,1H2,(H,4,5);/q;;+2/p-1.
What are the key properties of zinc;3-(6-oxobenzo[c][2,1]benzoxaphosphinin-6-yl)propanoate;prop-2-enoic acid?
zinc;3-(6-oxobenzo[c][2,1]benzoxaphosphinin-6-yl)propanoate;prop-2-enoic acid has a molecular weight of 424.68 g/mol, XLogP of 2.04, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for zinc;3-(6-oxobenzo[c][2,1]benzoxaphosphinin-6-yl)propanoate;prop-2-enoic acid is sourced from PubChem (CID 161370462), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).