C29H38N3O5P — CID 123748033
6-[4-[[4,6-bis(2-methylbutoxy)-1,3,5-triazin-2-yl]oxy]butyl]benzo[c][2,1]benzoxaphosphinine 6-oxide (PubChem CID 123748033) has the molecular formula C29H38N3O5P and a molecular weight of 539.61 g/mol. Its IUPAC name is 6-[4-[[4,6-bis(2-methylbutoxy)-1,3,5-triazin-2-yl]oxy]butyl]benzo[c][2,1]benzoxaphosphinine 6-oxide.
| Compound Name | 6-[4-[[4,6-bis(2-methylbutoxy)-1,3,5-triazin-2-yl]oxy]butyl]benzo[c][2,1]benzoxaphosphinine 6-oxide |
|---|---|
| PubChem CID | 123748033 |
| Molecular Formula | C29H38N3O5P |
| Molecular Weight | 539.61 g/mol |
| Exact Mass | 539.25 |
| IUPAC Name | 6-[4-[[4,6-bis(2-methylbutoxy)-1,3,5-triazin-2-yl]oxy]butyl]benzo[c][2,1]benzoxaphosphinine 6-oxide |
| SMILES | CCC(C)COc1nc(OCCCCP2(=O)Oc3ccccc3-c3ccccc32)nc(OCC(C)CC)n1 |
| InChI | InChI=1S/C29H38N3O5P/c1-5-21(3)19-35-28-30-27(31-29(32-28)36-20-22(4)6-2)34-17-11-12-18-38(33)26-16-10-8-14-24(26)23-13-7-9-15-25(23)37-38/h7-10,13-16,21-22H,5-6,11-12,17-20H2,1-4H3 |
| InChIKey | UMKJLRPCQUPKCT-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 92.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.61 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|