C21H29O7PSi — CID 101258265
1-(6-oxobenzo[c][2,1]benzoxaphosphinin-6-yl)-3-(3-trimethoxysilylpropoxy)propan-2-ol (PubChem CID 101258265) has the molecular formula C21H29O7PSi and a molecular weight of 452.52 g/mol. Its IUPAC name is 1-(6-oxobenzo[c][2,1]benzoxaphosphinin-6-yl)-3-(3-trimethoxysilylpropoxy)propan-2-ol.
| Compound Name | 1-(6-oxobenzo[c][2,1]benzoxaphosphinin-6-yl)-3-(3-trimethoxysilylpropoxy)propan-2-ol |
|---|---|
| PubChem CID | 101258265 |
| Molecular Formula | C21H29O7PSi |
| Molecular Weight | 452.52 g/mol |
| Exact Mass | 452.14 |
| IUPAC Name | 1-(6-oxobenzo[c][2,1]benzoxaphosphinin-6-yl)-3-(3-trimethoxysilylpropoxy)propan-2-ol |
| SMILES | CO[Si](CCCOCC(O)CP1(=O)Oc2ccccc2-c2ccccc21)(OC)OC |
| InChI | InChI=1S/C21H29O7PSi/c1-24-30(25-2,26-3)14-8-13-27-15-17(22)16-29(23)21-12-7-5-10-19(21)18-9-4-6-11-20(18)28-29/h4-7,9-12,17,22H,8,13-16H2,1-3H3 |
| InChIKey | KDYRWDSQANTKDA-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.52 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|