C28H34NO6PSi — CID 89432157
triethoxy-[2-[2-(6-oxobenzo[c][2,1]benzoxaphosphinin-6-yl)-2,4-dihydro-1,3-benzoxazin-3-yl]ethyl]silane (PubChem CID 89432157) has the molecular formula C28H34NO6PSi and a molecular weight of 539.64 g/mol. Its IUPAC name is triethoxy-[2-[2-(6-oxobenzo[c][2,1]benzoxaphosphinin-6-yl)-2,4-dihydro-1,3-benzoxazin-3-yl]ethyl]silane.
| Compound Name | triethoxy-[2-[2-(6-oxobenzo[c][2,1]benzoxaphosphinin-6-yl)-2,4-dihydro-1,3-benzoxazin-3-yl]ethyl]silane |
|---|---|
| PubChem CID | 89432157 |
| Molecular Formula | C28H34NO6PSi |
| Molecular Weight | 539.64 g/mol |
| Exact Mass | 539.19 |
| IUPAC Name | triethoxy-[2-[2-(6-oxobenzo[c][2,1]benzoxaphosphinin-6-yl)-2,4-dihydro-1,3-benzoxazin-3-yl]ethyl]silane |
| SMILES | CCO[Si](CCN1Cc2ccccc2OC1P1(=O)Oc2ccccc2-c2ccccc21)(OCC)OCC |
| InChI | InChI=1S/C28H34NO6PSi/c1-4-31-37(32-5-2,33-6-3)20-19-29-21-22-13-7-10-16-25(22)34-28(29)36(30)27-18-12-9-15-24(27)23-14-8-11-17-26(23)35-36/h7-18,28H,4-6,19-21H2,1-3H3 |
| InChIKey | RKFBZFYTEDSALR-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 66.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.64 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|