C14H14O4P2 — CID 123154087
methoxy-methyl-(6-oxobenzo[c][2,1]benzoxaphosphinin-6-yl)oxyphosphane (PubChem CID 123154087) has the molecular formula C14H14O4P2 and a molecular weight of 308.21 g/mol. Its IUPAC name is methoxy-methyl-(6-oxobenzo[c][2,1]benzoxaphosphinin-6-yl)oxyphosphane.
| Compound Name | methoxy-methyl-(6-oxobenzo[c][2,1]benzoxaphosphinin-6-yl)oxyphosphane |
|---|---|
| PubChem CID | 123154087 |
| Molecular Formula | C14H14O4P2 |
| Molecular Weight | 308.21 g/mol |
| Exact Mass | 308.04 |
| IUPAC Name | methoxy-methyl-(6-oxobenzo[c][2,1]benzoxaphosphinin-6-yl)oxyphosphane |
| SMILES | COP(C)OP1(=O)Oc2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C14H14O4P2/c1-16-19(2)18-20(15)14-10-6-4-8-12(14)11-7-3-5-9-13(11)17-20/h3-10H,1-2H3 |
| InChIKey | LKGQCHCNGAUQRS-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.21 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|