C15H15O3P — CID 90467370
6-ethoxy-3-methylbenzo[c][2,1]benzoxaphosphinine 6-oxide (PubChem CID 90467370) has the molecular formula C15H15O3P and a molecular weight of 274.26 g/mol. Its IUPAC name is 6-ethoxy-3-methylbenzo[c][2,1]benzoxaphosphinine 6-oxide.
| Compound Name | 6-ethoxy-3-methylbenzo[c][2,1]benzoxaphosphinine 6-oxide |
|---|---|
| PubChem CID | 90467370 |
| Molecular Formula | C15H15O3P |
| Molecular Weight | 274.26 g/mol |
| Exact Mass | 274.08 |
| IUPAC Name | 6-ethoxy-3-methylbenzo[c][2,1]benzoxaphosphinine 6-oxide |
| SMILES | CCOP1(=O)Oc2cc(C)ccc2-c2ccccc21 |
| InChI | InChI=1S/C15H15O3P/c1-3-17-19(16)15-7-5-4-6-13(15)12-9-8-11(2)10-14(12)18-19/h4-10H,3H2,1-2H3 |
| InChIKey | DKERWJMGZHXAGE-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.26 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|